C20H17N6O6+ — CID 90979558
(2,4-dinitrophenyl)-[2-(4-methylpyridin-1-ium-1-yl)-1-(4-nitrophenyl)ethyl]diazene (PubChem CID 90979558) has the molecular formula C20H17N6O6+ and a molecular weight of 437.39 g/mol. Its IUPAC name is (2,4-dinitrophenyl)-[2-(4-methylpyridin-1-ium-1-yl)-1-(4-nitrophenyl)ethyl]diazene.
| Compound Name | (2,4-dinitrophenyl)-[2-(4-methylpyridin-1-ium-1-yl)-1-(4-nitrophenyl)ethyl]diazene |
|---|---|
| PubChem CID | 90979558 |
| Molecular Formula | C20H17N6O6+ |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | (2,4-dinitrophenyl)-[2-(4-methylpyridin-1-ium-1-yl)-1-(4-nitrophenyl)ethyl]diazene |
| SMILES | Cc1cc[n+](CC(/N=N/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H17N6O6/c1-14-8-10-23(11-9-14)13-19(15-2-4-16(5-3-15)24(27)28)22-21-18-7-6-17(25(29)30)12-20(18)26(31)32/h2-12,19H,13H2,1H3/q+1/b22-21+ |
| InChIKey | SLCYHKZVOYDEDS-QURGRASLSA-N |
| XLogP | 4.53 |
| TPSA | 158.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|