C15H15N5O5 — CID 4052831
1-(N-methyl-2,4-dinitroanilino)-3-(2-methylphenyl)urea (PubChem CID 4052831) has the molecular formula C15H15N5O5 and a molecular weight of 345.32 g/mol. Its IUPAC name is 1-(N-methyl-2,4-dinitroanilino)-3-(2-methylphenyl)urea.
| Compound Name | 1-(N-methyl-2,4-dinitroanilino)-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 4052831 |
| Molecular Formula | C15H15N5O5 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-(N-methyl-2,4-dinitroanilino)-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)NN(C)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15N5O5/c1-10-5-3-4-6-12(10)16-15(21)17-18(2)13-8-7-11(19(22)23)9-14(13)20(24)25/h3-9H,1-2H3,(H2,16,17,21) |
| InChIKey | NYNIGTDIZYEXCZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|