C14H11F2N5O5 — CID 4546965
1-(2,4-difluorophenyl)-3-(N-methyl-2,4-dinitroanilino)urea (PubChem CID 4546965) has the molecular formula C14H11F2N5O5 and a molecular weight of 367.27 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(N-methyl-2,4-dinitroanilino)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(N-methyl-2,4-dinitroanilino)urea |
|---|---|
| PubChem CID | 4546965 |
| Molecular Formula | C14H11F2N5O5 |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(N-methyl-2,4-dinitroanilino)urea |
| SMILES | CN(NC(=O)Nc1ccc(F)cc1F)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H11F2N5O5/c1-19(12-5-3-9(20(23)24)7-13(12)21(25)26)18-14(22)17-11-4-2-8(15)6-10(11)16/h2-7H,1H3,(H2,17,18,22) |
| InChIKey | ZJHUPXVFBVBWHP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|