C19H12F2N4O5S — CID 3386859
1-(2,4-difluorophenyl)-3-[2-(2,4-dinitrophenyl)sulfanylphenyl]urea (PubChem CID 3386859) has the molecular formula C19H12F2N4O5S and a molecular weight of 446.39 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[2-(2,4-dinitrophenyl)sulfanylphenyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[2-(2,4-dinitrophenyl)sulfanylphenyl]urea |
|---|---|
| PubChem CID | 3386859 |
| Molecular Formula | C19H12F2N4O5S |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[2-(2,4-dinitrophenyl)sulfanylphenyl]urea |
| SMILES | O=C(Nc1ccc(F)cc1F)Nc1ccccc1Sc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H12F2N4O5S/c20-11-5-7-14(13(21)9-11)22-19(26)23-15-3-1-2-4-17(15)31-18-8-6-12(24(27)28)10-16(18)25(29)30/h1-10H,(H2,22,23,26) |
| InChIKey | AGMNARORZLCVKV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|