C19H13F2N3O3S — CID 18431163
1-(2,5-difluorophenyl)-3-[2-(4-nitrophenyl)sulfanylphenyl]urea (PubChem CID 18431163) has the molecular formula C19H13F2N3O3S and a molecular weight of 401.39 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-[2-(4-nitrophenyl)sulfanylphenyl]urea.
| Compound Name | 1-(2,5-difluorophenyl)-3-[2-(4-nitrophenyl)sulfanylphenyl]urea |
|---|---|
| PubChem CID | 18431163 |
| Molecular Formula | C19H13F2N3O3S |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-[2-(4-nitrophenyl)sulfanylphenyl]urea |
| SMILES | O=C(Nc1cc(F)ccc1F)Nc1ccccc1Sc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H13F2N3O3S/c20-12-5-10-15(21)17(11-12)23-19(25)22-16-3-1-2-4-18(16)28-14-8-6-13(7-9-14)24(26)27/h1-11H,(H2,22,23,25) |
| InChIKey | LAYOHRDRDJJBLN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|