C14H8N6O10 — CID 53437177
N',N'-bis(2,4-dinitrophenyl)oxamide (PubChem CID 53437177) has the molecular formula C14H8N6O10 and a molecular weight of 420.25 g/mol. Its IUPAC name is N',N'-bis(2,4-dinitrophenyl)oxamide.
| Compound Name | N',N'-bis(2,4-dinitrophenyl)oxamide |
|---|---|
| PubChem CID | 53437177 |
| Molecular Formula | C14H8N6O10 |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | N',N'-bis(2,4-dinitrophenyl)oxamide |
| SMILES | NC(=O)C(=O)N(c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H8N6O10/c15-13(21)14(22)16(9-3-1-7(17(23)24)5-11(9)19(27)28)10-4-2-8(18(25)26)6-12(10)20(29)30/h1-6H,(H2,15,21) |
| InChIKey | BEKRDXMHLLFUJX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 235.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|