C12H9N5O6 — CID 119091498
2-(N-amino-2,4-dinitroanilino)pyridine-3-carboxylic acid (PubChem CID 119091498) has the molecular formula C12H9N5O6 and a molecular weight of 319.23 g/mol. Its IUPAC name is 2-(N-amino-2,4-dinitroanilino)pyridine-3-carboxylic acid.
| Compound Name | 2-(N-amino-2,4-dinitroanilino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 119091498 |
| Molecular Formula | C12H9N5O6 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-(N-amino-2,4-dinitroanilino)pyridine-3-carboxylic acid |
| SMILES | NN(c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ncccc1C(=O)O |
| InChI | InChI=1S/C12H9N5O6/c13-15(11-8(12(18)19)2-1-5-14-11)9-4-3-7(16(20)21)6-10(9)17(22)23/h1-6H,13H2,(H,18,19) |
| InChIKey | PSNHLMYEXUQCFF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 165.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|