C17H18N4O6 — CID 71914572
ethyl 3-[2,4-dinitro-N-(pyridin-3-ylmethyl)anilino]propanoate (PubChem CID 71914572) has the molecular formula C17H18N4O6 and a molecular weight of 374.35 g/mol. Its IUPAC name is ethyl 3-[2,4-dinitro-N-(pyridin-3-ylmethyl)anilino]propanoate.
| Compound Name | ethyl 3-[2,4-dinitro-N-(pyridin-3-ylmethyl)anilino]propanoate |
|---|---|
| PubChem CID | 71914572 |
| Molecular Formula | C17H18N4O6 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | ethyl 3-[2,4-dinitro-N-(pyridin-3-ylmethyl)anilino]propanoate |
| SMILES | CCOC(=O)CCN(Cc1cccnc1)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N4O6/c1-2-27-17(22)7-9-19(12-13-4-3-8-18-11-13)15-6-5-14(20(23)24)10-16(15)21(25)26/h3-6,8,10-11H,2,7,9,12H2,1H3 |
| InChIKey | QRSJDAMNVZWGSE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 128.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|