C17H26N4O2 — CID 31658265
2-[[(2S)-2-(diethylamino)-4-methylpentyl]amino]-5-nitrobenzonitrile (PubChem CID 31658265) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-[[(2S)-2-(diethylamino)-4-methylpentyl]amino]-5-nitrobenzonitrile.
| Compound Name | 2-[[(2S)-2-(diethylamino)-4-methylpentyl]amino]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 31658265 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 2-[[(2S)-2-(diethylamino)-4-methylpentyl]amino]-5-nitrobenzonitrile |
| SMILES | CCN(CC)[C@H](CNc1ccc([N+](=O)[O-])cc1C#N)CC(C)C |
| InChI | InChI=1S/C17H26N4O2/c1-5-20(6-2)16(9-13(3)4)12-19-17-8-7-15(21(22)23)10-14(17)11-18/h7-8,10,13,16,19H,5-6,9,12H2,1-4H3/t16-/m0/s1 |
| InChIKey | HCUDXBSGVWLHDP-INIZCTEOSA-N |
| XLogP | 3.63 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|