C13H16F2N4O2 — CID 86807771
2-[2-[2,2-difluoroethyl(ethyl)amino]ethylamino]-5-nitrobenzonitrile (PubChem CID 86807771) has the molecular formula C13H16F2N4O2 and a molecular weight of 298.29 g/mol. Its IUPAC name is 2-[2-[2,2-difluoroethyl(ethyl)amino]ethylamino]-5-nitrobenzonitrile.
| Compound Name | 2-[2-[2,2-difluoroethyl(ethyl)amino]ethylamino]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 86807771 |
| Molecular Formula | C13H16F2N4O2 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-[2-[2,2-difluoroethyl(ethyl)amino]ethylamino]-5-nitrobenzonitrile |
| SMILES | CCN(CCNc1ccc([N+](=O)[O-])cc1C#N)CC(F)F |
| InChI | InChI=1S/C13H16F2N4O2/c1-2-18(9-13(14)15)6-5-17-12-4-3-11(19(20)21)7-10(12)8-16/h3-4,7,13,17H,2,5-6,9H2,1H3 |
| InChIKey | UPOQLMNBRAFZTE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|