C15H16BrN3O4S2 — CID 133296525
4-[2-(4-bromophenyl)sulfanylpropylamino]-3-nitrobenzenesulfonamide (PubChem CID 133296525) has the molecular formula C15H16BrN3O4S2 and a molecular weight of 446.35 g/mol. Its IUPAC name is 4-[2-(4-bromophenyl)sulfanylpropylamino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-(4-bromophenyl)sulfanylpropylamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133296525 |
| Molecular Formula | C15H16BrN3O4S2 |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 444.98 |
| IUPAC Name | 4-[2-(4-bromophenyl)sulfanylpropylamino]-3-nitrobenzenesulfonamide |
| SMILES | CC(CNc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-])Sc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H16BrN3O4S2/c1-10(24-12-4-2-11(16)3-5-12)9-18-14-7-6-13(25(17,22)23)8-15(14)19(20)21/h2-8,10,18H,9H2,1H3,(H2,17,22,23) |
| InChIKey | AZCLPJLOTLWSGH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|