C11H13N3O6S — CID 175096258
[4-[(1-methylcyclopropyl)sulfamoyl]-2-nitrophenyl] carbamate (PubChem CID 175096258) has the molecular formula C11H13N3O6S and a molecular weight of 315.31 g/mol. Its IUPAC name is [4-[(1-methylcyclopropyl)sulfamoyl]-2-nitrophenyl] carbamate.
| Compound Name | [4-[(1-methylcyclopropyl)sulfamoyl]-2-nitrophenyl] carbamate |
|---|---|
| PubChem CID | 175096258 |
| Molecular Formula | C11H13N3O6S |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | [4-[(1-methylcyclopropyl)sulfamoyl]-2-nitrophenyl] carbamate |
| SMILES | CC1(NS(=O)(=O)c2ccc(OC(N)=O)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C11H13N3O6S/c1-11(4-5-11)13-21(18,19)7-2-3-9(20-10(12)15)8(6-7)14(16)17/h2-3,6,13H,4-5H2,1H3,(H2,12,15) |
| InChIKey | NZMPWQIPQQXFGD-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|