C13H14FN3O3S — CID 133406273
N-[(2,5-dimethyl-1,3-thiazol-4-yl)methyl]-4-fluoro-5-methoxy-2-nitroaniline (PubChem CID 133406273) has the molecular formula C13H14FN3O3S and a molecular weight of 311.34 g/mol. Its IUPAC name is N-[(2,5-dimethyl-1,3-thiazol-4-yl)methyl]-4-fluoro-5-methoxy-2-nitroaniline.
| Compound Name | N-[(2,5-dimethyl-1,3-thiazol-4-yl)methyl]-4-fluoro-5-methoxy-2-nitroaniline |
|---|---|
| PubChem CID | 133406273 |
| Molecular Formula | C13H14FN3O3S |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | N-[(2,5-dimethyl-1,3-thiazol-4-yl)methyl]-4-fluoro-5-methoxy-2-nitroaniline |
| SMILES | COc1cc(NCc2nc(C)sc2C)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C13H14FN3O3S/c1-7-11(16-8(2)21-7)6-15-10-5-13(20-3)9(14)4-12(10)17(18)19/h4-5,15H,6H2,1-3H3 |
| InChIKey | PVWDOHWJGQFEFU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|