C14H13N3O7S — CID 108778443
methyl 2-hydroxy-3-(2-nitro-4-sulfamoylanilino)benzoate (PubChem CID 108778443) has the molecular formula C14H13N3O7S and a molecular weight of 367.34 g/mol. Its IUPAC name is methyl 2-hydroxy-3-(2-nitro-4-sulfamoylanilino)benzoate.
| Compound Name | methyl 2-hydroxy-3-(2-nitro-4-sulfamoylanilino)benzoate |
|---|---|
| PubChem CID | 108778443 |
| Molecular Formula | C14H13N3O7S |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | methyl 2-hydroxy-3-(2-nitro-4-sulfamoylanilino)benzoate |
| SMILES | COC(=O)c1cccc(Nc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])c1O |
| InChI | InChI=1S/C14H13N3O7S/c1-24-14(19)9-3-2-4-11(13(9)18)16-10-6-5-8(25(15,22)23)7-12(10)17(20)21/h2-7,16,18H,1H3,(H2,15,22,23) |
| InChIKey | DVSIXLFSKFTMEY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 161.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|