C17H19N3O9S — CID 108776162
diethyl 2-methyl-5-(2-nitro-4-sulfamoylanilino)furan-3,4-dicarboxylate (PubChem CID 108776162) has the molecular formula C17H19N3O9S and a molecular weight of 441.42 g/mol. Its IUPAC name is diethyl 2-methyl-5-(2-nitro-4-sulfamoylanilino)furan-3,4-dicarboxylate.
| Compound Name | diethyl 2-methyl-5-(2-nitro-4-sulfamoylanilino)furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 108776162 |
| Molecular Formula | C17H19N3O9S |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | diethyl 2-methyl-5-(2-nitro-4-sulfamoylanilino)furan-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)oc(Nc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])c1C(=O)OCC |
| InChI | InChI=1S/C17H19N3O9S/c1-4-27-16(21)13-9(3)29-15(14(13)17(22)28-5-2)19-11-7-6-10(30(18,25)26)8-12(11)20(23)24/h6-8,19H,4-5H2,1-3H3,(H2,18,25,26) |
| InChIKey | WXHHOZRKAWDGHU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 181.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|