C16H20N6O6S3 — CID 3671921
1-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-(2-nitro-4-sulfamoylanilino)thiourea (PubChem CID 3671921) has the molecular formula C16H20N6O6S3 and a molecular weight of 488.57 g/mol. Its IUPAC name is 1-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-(2-nitro-4-sulfamoylanilino)thiourea.
| Compound Name | 1-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-(2-nitro-4-sulfamoylanilino)thiourea |
|---|---|
| PubChem CID | 3671921 |
| Molecular Formula | C16H20N6O6S3 |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | 1-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-(2-nitro-4-sulfamoylanilino)thiourea |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=S)NNc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20N6O6S3/c1-10-4-5-12(31(27,28)21(2)3)8-14(10)18-16(29)20-19-13-7-6-11(30(17,25)26)9-15(13)22(23)24/h4-9,19H,1-3H3,(H2,17,25,26)(H2,18,20,29) |
| InChIKey | UHYNKNJXDATJSO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 176.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_urea_D(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|