C16H16N4O4S — CID 23723088
4-[2-[(3,4-dimethylphenyl)carbamothioyl]hydrazinyl]-3-nitrobenzoic acid (PubChem CID 23723088) has the molecular formula C16H16N4O4S and a molecular weight of 360.40 g/mol. Its IUPAC name is 4-[2-[(3,4-dimethylphenyl)carbamothioyl]hydrazinyl]-3-nitrobenzoic acid.
| Compound Name | 4-[2-[(3,4-dimethylphenyl)carbamothioyl]hydrazinyl]-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 23723088 |
| Molecular Formula | C16H16N4O4S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 4-[2-[(3,4-dimethylphenyl)carbamothioyl]hydrazinyl]-3-nitrobenzoic acid |
| SMILES | Cc1ccc(NC(=S)NNc2ccc(C(=O)O)cc2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C16H16N4O4S/c1-9-3-5-12(7-10(9)2)17-16(25)19-18-13-6-4-11(15(21)22)8-14(13)20(23)24/h3-8,18H,1-2H3,(H,21,22)(H2,17,19,25) |
| InChIKey | UCFUCTDJCXWQDQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_D(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|