C14H19N5O4S — CID 8657165
1-(2,4-dinitroanilino)-3-[(1R,2R)-2-methylcyclohexyl]thiourea (PubChem CID 8657165) has the molecular formula C14H19N5O4S and a molecular weight of 353.40 g/mol. Its IUPAC name is 1-(2,4-dinitroanilino)-3-[(1R,2R)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-(2,4-dinitroanilino)-3-[(1R,2R)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 8657165 |
| Molecular Formula | C14H19N5O4S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 1-(2,4-dinitroanilino)-3-[(1R,2R)-2-methylcyclohexyl]thiourea |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=S)NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N5O4S/c1-9-4-2-3-5-11(9)15-14(24)17-16-12-7-6-10(18(20)21)8-13(12)19(22)23/h6-9,11,16H,2-5H2,1H3,(H2,15,17,24)/t9-,11-/m1/s1 |
| InChIKey | BOPJSUSRHONJDL-MWLCHTKSSA-N |
| XLogP | 2.87 |
| TPSA | 122.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|