C16H22N4O2S — CID 9122175
1-[(1S,2R)-2-methylcyclohexyl]-3-[(Z)-1-(3-nitrophenyl)ethylideneamino]thiourea (PubChem CID 9122175) has the molecular formula C16H22N4O2S and a molecular weight of 334.44 g/mol. Its IUPAC name is 1-[(1S,2R)-2-methylcyclohexyl]-3-[(Z)-1-(3-nitrophenyl)ethylideneamino]thiourea.
| Compound Name | 1-[(1S,2R)-2-methylcyclohexyl]-3-[(Z)-1-(3-nitrophenyl)ethylideneamino]thiourea |
|---|---|
| PubChem CID | 9122175 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-[(1S,2R)-2-methylcyclohexyl]-3-[(Z)-1-(3-nitrophenyl)ethylideneamino]thiourea |
| SMILES | C/C(=N/NC(=S)N[C@H]1CCCC[C@H]1C)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H22N4O2S/c1-11-6-3-4-9-15(11)17-16(23)19-18-12(2)13-7-5-8-14(10-13)20(21)22/h5,7-8,10-11,15H,3-4,6,9H2,1-2H3,(H2,17,19,23)/b18-12-/t11-,15+/m1/s1 |
| InChIKey | JBNBEOCMYVFIMA-PNKJQRRLSA-N |
| XLogP | 3.36 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|