C15H20N4O4S — CID 152620626
methyl (3R,4R)-3-methyl-4-[(2-nitrophenyl)carbamothioylamino]piperidine-1-carboxylate (PubChem CID 152620626) has the molecular formula C15H20N4O4S and a molecular weight of 352.42 g/mol. Its IUPAC name is methyl (3R,4R)-3-methyl-4-[(2-nitrophenyl)carbamothioylamino]piperidine-1-carboxylate.
| Compound Name | methyl (3R,4R)-3-methyl-4-[(2-nitrophenyl)carbamothioylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 152620626 |
| Molecular Formula | C15H20N4O4S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | methyl (3R,4R)-3-methyl-4-[(2-nitrophenyl)carbamothioylamino]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CC[C@@H](NC(=S)Nc2ccccc2[N+](=O)[O-])[C@H](C)C1 |
| InChI | InChI=1S/C15H20N4O4S/c1-10-9-18(15(20)23-2)8-7-11(10)16-14(24)17-12-5-3-4-6-13(12)19(21)22/h3-6,10-11H,7-9H2,1-2H3,(H2,16,17,24)/t10-,11-/m1/s1 |
| InChIKey | ZBKZDXPQHHYWRP-GHMZBOCLSA-N |
| XLogP | 2.36 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|