C13H14F2N4O3S — CID 164960924
O-(3,3-difluoro-2-methylprop-2-enyl) 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethanethioate (PubChem CID 164960924) has the molecular formula C13H14F2N4O3S and a molecular weight of 344.34 g/mol. Its IUPAC name is O-(3,3-difluoro-2-methylprop-2-enyl) 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethanethioate.
| Compound Name | O-(3,3-difluoro-2-methylprop-2-enyl) 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethanethioate |
|---|---|
| PubChem CID | 164960924 |
| Molecular Formula | C13H14F2N4O3S |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | O-(3,3-difluoro-2-methylprop-2-enyl) 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethanethioate |
| SMILES | CC(COC(=S)Cn1cnc2c1c(=O)n(C)c(=O)n2C)=C(F)F |
| InChI | InChI=1S/C13H14F2N4O3S/c1-7(10(14)15)5-22-8(23)4-19-6-16-11-9(19)12(20)18(3)13(21)17(11)2/h6H,4-5H2,1-3H3 |
| InChIKey | CXRFEHWYKNVRLW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|