C22H30N6O4 — CID 69053752
4-ethoxy-3-[[2-[1-methyl-3-(2-methylpropyl)-2,6-dioxopurin-7-yl]ethylamino]methyl]benzamide (PubChem CID 69053752) has the molecular formula C22H30N6O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 4-ethoxy-3-[[2-[1-methyl-3-(2-methylpropyl)-2,6-dioxopurin-7-yl]ethylamino]methyl]benzamide.
| Compound Name | 4-ethoxy-3-[[2-[1-methyl-3-(2-methylpropyl)-2,6-dioxopurin-7-yl]ethylamino]methyl]benzamide |
|---|---|
| PubChem CID | 69053752 |
| Molecular Formula | C22H30N6O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 4-ethoxy-3-[[2-[1-methyl-3-(2-methylpropyl)-2,6-dioxopurin-7-yl]ethylamino]methyl]benzamide |
| SMILES | CCOc1ccc(C(N)=O)cc1CNCCn1cnc2c1c(=O)n(C)c(=O)n2CC(C)C |
| InChI | InChI=1S/C22H30N6O4/c1-5-32-17-7-6-15(19(23)29)10-16(17)11-24-8-9-27-13-25-20-18(27)21(30)26(4)22(31)28(20)12-14(2)3/h6-7,10,13-14,24H,5,8-9,11-12H2,1-4H3,(H2,23,29) |
| InChIKey | YXIQHBSFQYDXAX-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|