C19H27N5O3 — CID 163309791
1,3-dimethyl-7-[2-(4-methyl-1-oxa-9-azaspiro[5.5]undec-4-en-9-yl)ethyl]purine-2,6-dione (PubChem CID 163309791) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-(4-methyl-1-oxa-9-azaspiro[5.5]undec-4-en-9-yl)ethyl]purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-[2-(4-methyl-1-oxa-9-azaspiro[5.5]undec-4-en-9-yl)ethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 163309791 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 1,3-dimethyl-7-[2-(4-methyl-1-oxa-9-azaspiro[5.5]undec-4-en-9-yl)ethyl]purine-2,6-dione |
| SMILES | CC1=CC2(CCN(CCn3cnc4c3c(=O)n(C)c(=O)n4C)CC2)OCC1 |
| InChI | InChI=1S/C19H27N5O3/c1-14-4-11-27-19(12-14)5-7-23(8-6-19)9-10-24-13-20-16-15(24)17(25)22(3)18(26)21(16)2/h12-13H,4-11H2,1-3H3 |
| InChIKey | YHGMMXCPTZXILZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 74.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|