C24H29N4O4+ — CID 2029097
N-[(Z)-1-(1-ethylindol-3-yl)-3-(2-morpholin-4-ium-4-ylethylamino)-3-oxoprop-1-en-2-yl]furan-2-carboxamide (PubChem CID 2029097) has the molecular formula C24H29N4O4+ and a molecular weight of 437.52 g/mol. Its IUPAC name is N-[(Z)-1-(1-ethylindol-3-yl)-3-(2-morpholin-4-ium-4-ylethylamino)-3-oxoprop-1-en-2-yl]furan-2-carboxamide.
| Compound Name | N-[(Z)-1-(1-ethylindol-3-yl)-3-(2-morpholin-4-ium-4-ylethylamino)-3-oxoprop-1-en-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2029097 |
| Molecular Formula | C24H29N4O4+ |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | N-[(Z)-1-(1-ethylindol-3-yl)-3-(2-morpholin-4-ium-4-ylethylamino)-3-oxoprop-1-en-2-yl]furan-2-carboxamide |
| SMILES | CCn1cc(/C=C(\NC(=O)c2ccco2)C(=O)NCC[NH+]2CCOCC2)c2ccccc21 |
| InChI | InChI=1S/C24H28N4O4/c1-2-28-17-18(19-6-3-4-7-21(19)28)16-20(26-24(30)22-8-5-13-32-22)23(29)25-9-10-27-11-14-31-15-12-27/h3-8,13,16-17H,2,9-12,14-15H2,1H3,(H,25,29)(H,26,30)/p+1/b20-16- |
| InChIKey | JMHLXWXVUPDJIA-SILNSSARSA-O |
| XLogP | 1.06 |
| TPSA | 89.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|