C28H25FN4O3 — CID 17038956
N-[(Z)-1-(1-ethylindol-3-yl)-3-[2-(5-fluoro-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]furan-2-carboxamide (PubChem CID 17038956) has the molecular formula C28H25FN4O3 and a molecular weight of 484.53 g/mol. Its IUPAC name is N-[(Z)-1-(1-ethylindol-3-yl)-3-[2-(5-fluoro-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]furan-2-carboxamide.
| Compound Name | N-[(Z)-1-(1-ethylindol-3-yl)-3-[2-(5-fluoro-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17038956 |
| Molecular Formula | C28H25FN4O3 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | N-[(Z)-1-(1-ethylindol-3-yl)-3-[2-(5-fluoro-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]furan-2-carboxamide |
| SMILES | CCn1cc(/C=C(\NC(=O)c2ccco2)C(=O)NCCc2c[nH]c3ccc(F)cc23)c2ccccc21 |
| InChI | InChI=1S/C28H25FN4O3/c1-2-33-17-19(21-6-3-4-7-25(21)33)14-24(32-28(35)26-8-5-13-36-26)27(34)30-12-11-18-16-31-23-10-9-20(29)15-22(18)23/h3-10,13-17,31H,2,11-12H2,1H3,(H,30,34)(H,32,35)/b24-14- |
| InChIKey | DWUSRJBIKFTNPJ-OYKKKHCWSA-N |
| XLogP | 5.00 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|