C19H23FIN5O2 — CID 111972111
N-[2-[[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide (PubChem CID 111972111) has the molecular formula C19H23FIN5O2 and a molecular weight of 499.33 g/mol. Its IUPAC name is N-[2-[[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111972111 |
| Molecular Formula | C19H23FIN5O2 |
| Molecular Weight | 499.33 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | N-[2-[[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1ccco1)NCCc1c[nH]c2ccc(F)cc12.I |
| InChI | InChI=1S/C19H22FN5O2.HI/c1-21-19(24-9-8-22-18(26)17-3-2-10-27-17)23-7-6-13-12-25-16-5-4-14(20)11-15(13)16;/h2-5,10-12,25H,6-9H2,1H3,(H,22,26)(H2,21,23,24);1H |
| InChIKey | RBVAMQGSDMAWBE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|