C24H32N3O4+ — CID 9150397
tert-butyl N-[3-[[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]carbamoyl]phenyl]carbamate (PubChem CID 9150397) has the molecular formula C24H32N3O4+ and a molecular weight of 426.54 g/mol. Its IUPAC name is tert-butyl N-[3-[[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 9150397 |
| Molecular Formula | C24H32N3O4+ |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | tert-butyl N-[3-[[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]carbamoyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(C(=O)N[C@@H](C[NH+]2CCOCC2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H31N3O4/c1-24(2,3)31-23(29)25-20-11-7-10-19(16-20)22(28)26-21(18-8-5-4-6-9-18)17-27-12-14-30-15-13-27/h4-11,16,21H,12-15,17H2,1-3H3,(H,25,29)(H,26,28)/p+1/t21-/m0/s1 |
| InChIKey | CPZDZBINFDVTGD-NRFANRHFSA-O |
| XLogP | 2.42 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |