C20H32N4O3S — CID 112832261
1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-3-[[4-(diethylsulfamoyl)phenyl]methyl]urea (PubChem CID 112832261) has the molecular formula C20H32N4O3S and a molecular weight of 408.57 g/mol. Its IUPAC name is 1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-3-[[4-(diethylsulfamoyl)phenyl]methyl]urea.
| Compound Name | 1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-3-[[4-(diethylsulfamoyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 112832261 |
| Molecular Formula | C20H32N4O3S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-3-[[4-(diethylsulfamoyl)phenyl]methyl]urea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNC(=O)NCC2CCN(C3CC3)C2)cc1 |
| InChI | InChI=1S/C20H32N4O3S/c1-3-24(4-2)28(26,27)19-9-5-16(6-10-19)13-21-20(25)22-14-17-11-12-23(15-17)18-7-8-18/h5-6,9-10,17-18H,3-4,7-8,11-15H2,1-2H3,(H2,21,22,25) |
| InChIKey | IWMXTLKQPJYYSS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |