C16H21N5O4S2 — CID 111259859
2-methyl-1-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 111259859) has the molecular formula C16H21N5O4S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111259859 |
| Molecular Formula | C16H21N5O4S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 2-methyl-1-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | C/N=C(/NCCNc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-])NCc1cccs1 |
| InChI | InChI=1S/C16H21N5O4S2/c1-17-16(20-11-12-4-3-9-26-12)19-8-7-18-14-6-5-13(27(2,24)25)10-15(14)21(22)23/h3-6,9-10,18H,7-8,11H2,1-2H3,(H2,17,19,20) |
| InChIKey | MCVGBBSQDAQUAB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 125.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|