C17H16N4O6S2 — CID 18286310
N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide (PubChem CID 18286310) has the molecular formula C17H16N4O6S2 and a molecular weight of 436.47 g/mol. Its IUPAC name is N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 18286310 |
| Molecular Formula | C17H16N4O6S2 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(NCCNC(=O)c2cc(-c3cccs3)on2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N4O6S2/c1-29(25,26)11-4-5-12(14(9-11)21(23)24)18-6-7-19-17(22)13-10-15(27-20-13)16-3-2-8-28-16/h2-5,8-10,18H,6-7H2,1H3,(H,19,22) |
| InChIKey | IMWDNBXOUGELRJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 144.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|