C17H28N4O4S — CID 9280789
N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 9280789) has the molecular formula C17H28N4O4S and a molecular weight of 384.50 g/mol. Its IUPAC name is N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 9280789 |
| Molecular Formula | C17H28N4O4S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | C[C@@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(NCCN(C)C)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C17H28N4O4S/c1-13-9-14(2)12-20(11-13)26(24,25)15-5-6-16(17(10-15)21(22)23)18-7-8-19(3)4/h5-6,10,13-14,18H,7-9,11-12H2,1-4H3/t13-,14+ |
| InChIKey | ABYWHRIOOUOHAT-OKILXGFUSA-N |
| XLogP | 2.23 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|