C23H28N4O5S — CID 30961571
(3S)-3-[2-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitroanilino]ethyl]-1,3-dihydroindol-2-one (PubChem CID 30961571) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is (3S)-3-[2-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitroanilino]ethyl]-1,3-dihydroindol-2-one.
| Compound Name | (3S)-3-[2-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitroanilino]ethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 30961571 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | (3S)-3-[2-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitroanilino]ethyl]-1,3-dihydroindol-2-one |
| SMILES | C[C@@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(NCC[C@@H]3C(=O)Nc4ccccc43)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C23H28N4O5S/c1-15-11-16(2)14-26(13-15)33(31,32)17-7-8-21(22(12-17)27(29)30)24-10-9-19-18-5-3-4-6-20(18)25-23(19)28/h3-8,12,15-16,19,24H,9-11,13-14H2,1-2H3,(H,25,28)/t15-,16+,19-/m0/s1 |
| InChIKey | ZROUUZNJWDPZTO-FCEWJHQRSA-N |
| XLogP | 3.80 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|