C20H27N5O4S — CID 95765715
N'-[4-[(3S)-3-methylpiperidin-1-yl]sulfonyl-2-nitrophenyl]-N-pyridin-4-ylpropane-1,3-diamine (PubChem CID 95765715) has the molecular formula C20H27N5O4S and a molecular weight of 433.53 g/mol. Its IUPAC name is N'-[4-[(3S)-3-methylpiperidin-1-yl]sulfonyl-2-nitrophenyl]-N-pyridin-4-ylpropane-1,3-diamine.
| Compound Name | N'-[4-[(3S)-3-methylpiperidin-1-yl]sulfonyl-2-nitrophenyl]-N-pyridin-4-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 95765715 |
| Molecular Formula | C20H27N5O4S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N'-[4-[(3S)-3-methylpiperidin-1-yl]sulfonyl-2-nitrophenyl]-N-pyridin-4-ylpropane-1,3-diamine |
| SMILES | C[C@H]1CCCN(S(=O)(=O)c2ccc(NCCCNc3ccncc3)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C20H27N5O4S/c1-16-4-2-13-24(15-16)30(28,29)18-5-6-19(20(14-18)25(26)27)23-10-3-9-22-17-7-11-21-12-8-17/h5-8,11-12,14,16,23H,2-4,9-10,13,15H2,1H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | IHMFHXHUEYOFLM-INIZCTEOSA-N |
| XLogP | 3.32 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|