C22H32N6O5S — CID 51957189
2-[3-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitroanilino]propyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 51957189) has the molecular formula C22H32N6O5S and a molecular weight of 492.60 g/mol. Its IUPAC name is 2-[3-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitroanilino]propyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[3-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitroanilino]propyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 51957189 |
| Molecular Formula | C22H32N6O5S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 2-[3-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitroanilino]propyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | C[C@@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(NCCCn3nc4n(c3=O)CCCC4)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C22H32N6O5S/c1-16-12-17(2)15-25(14-16)34(32,33)18-7-8-19(20(13-18)28(30)31)23-9-5-11-27-22(29)26-10-4-3-6-21(26)24-27/h7-8,13,16-17,23H,3-6,9-12,14-15H2,1-2H3/t16-,17+ |
| InChIKey | FQTAOVAUIUSDGK-CALCHBBNSA-N |
| XLogP | 2.46 |
| TPSA | 132.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|