C18H28N4O5S — CID 9110009
2-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-methyl-2-nitroanilino]-N,N-dimethylacetamide (PubChem CID 9110009) has the molecular formula C18H28N4O5S and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-methyl-2-nitroanilino]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-methyl-2-nitroanilino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 9110009 |
| Molecular Formula | C18H28N4O5S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 2-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-methyl-2-nitroanilino]-N,N-dimethylacetamide |
| SMILES | C[C@@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(N(C)CC(=O)N(C)C)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C18H28N4O5S/c1-13-8-14(2)11-21(10-13)28(26,27)15-6-7-16(17(9-15)22(24)25)20(5)12-18(23)19(3)4/h6-7,9,13-14H,8,10-12H2,1-5H3/t13-,14+ |
| InChIKey | AJWBPTPMSKXZSY-OKILXGFUSA-N |
| XLogP | 1.79 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|