C21H27N5O4S — CID 110947102
N-ethyl-N'-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 110947102) has the molecular formula C21H27N5O4S and a molecular weight of 445.55 g/mol. Its IUPAC name is N-ethyl-N'-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 110947102 |
| Molecular Formula | C21H27N5O4S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-ethyl-N'-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | CCN/C(=N\CCNc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-])N1CCc2ccccc2C1 |
| InChI | InChI=1S/C21H27N5O4S/c1-3-22-21(25-13-10-16-6-4-5-7-17(16)15-25)24-12-11-23-19-9-8-18(31(2,29)30)14-20(19)26(27)28/h4-9,14,23H,3,10-13,15H2,1-2H3,(H,22,24) |
| InChIKey | TWRFWTRHRGPUAV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|