C18H29N5O4S — CID 111738576
N-ethyl-3,3-dimethyl-N'-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]pyrrolidine-1-carboximidamide (PubChem CID 111738576) has the molecular formula C18H29N5O4S and a molecular weight of 411.53 g/mol. Its IUPAC name is N-ethyl-3,3-dimethyl-N'-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3,3-dimethyl-N'-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111738576 |
| Molecular Formula | C18H29N5O4S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | N-ethyl-3,3-dimethyl-N'-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCNc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-])N1CCC(C)(C)C1 |
| InChI | InChI=1S/C18H29N5O4S/c1-5-19-17(22-11-8-18(2,3)13-22)21-10-9-20-15-7-6-14(28(4,26)27)12-16(15)23(24)25/h6-7,12,20H,5,8-11,13H2,1-4H3,(H,19,21) |
| InChIKey | YHWZCGXBQCZGKM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|