C16H24N4O2 — CID 111738874
N-ethyl-3,3-dimethyl-N'-[(2-nitrophenyl)methyl]pyrrolidine-1-carboximidamide (PubChem CID 111738874) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-ethyl-3,3-dimethyl-N'-[(2-nitrophenyl)methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3,3-dimethyl-N'-[(2-nitrophenyl)methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111738874 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | N-ethyl-3,3-dimethyl-N'-[(2-nitrophenyl)methyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccccc1[N+](=O)[O-])N1CCC(C)(C)C1 |
| InChI | InChI=1S/C16H24N4O2/c1-4-17-15(19-10-9-16(2,3)12-19)18-11-13-7-5-6-8-14(13)20(21)22/h5-8H,4,9-12H2,1-3H3,(H,17,18) |
| InChIKey | JKANPLVPXGLZHH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|