C26H31N3O5S — CID 51110568
N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-3-phenyladamantane-1-carboxamide (PubChem CID 51110568) has the molecular formula C26H31N3O5S and a molecular weight of 497.62 g/mol. Its IUPAC name is N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-3-phenyladamantane-1-carboxamide.
| Compound Name | N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-3-phenyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 51110568 |
| Molecular Formula | C26H31N3O5S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-3-phenyladamantane-1-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(NCCNC(=O)C23CC4CC(C2)CC(c2ccccc2)(C4)C3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H31N3O5S/c1-35(33,34)21-7-8-22(23(12-21)29(31)32)27-9-10-28-24(30)26-15-18-11-19(16-26)14-25(13-18,17-26)20-5-3-2-4-6-20/h2-8,12,18-19,27H,9-11,13-17H2,1H3,(H,28,30) |
| InChIKey | DRHMKEVFBQDDJD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|