C17H18ClN3O6S — CID 41178529
(2S)-2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-(3-nitrophenyl)propanamide (PubChem CID 41178529) has the molecular formula C17H18ClN3O6S and a molecular weight of 427.87 g/mol. Its IUPAC name is (2S)-2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-(3-nitrophenyl)propanamide.
| Compound Name | (2S)-2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-(3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 41178529 |
| Molecular Formula | C17H18ClN3O6S |
| Molecular Weight | 427.87 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | (2S)-2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-(3-nitrophenyl)propanamide |
| SMILES | COc1ccc(Cl)cc1N([C@@H](C)C(=O)Nc1cccc([N+](=O)[O-])c1)S(C)(=O)=O |
| InChI | InChI=1S/C17H18ClN3O6S/c1-11(17(22)19-13-5-4-6-14(10-13)21(23)24)20(28(3,25)26)15-9-12(18)7-8-16(15)27-2/h4-11H,1-3H3,(H,19,22)/t11-/m0/s1 |
| InChIKey | NSOQAIGQGDYPPD-NSHDSACASA-N |
| XLogP | 3.05 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.87 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|