C20H23ClN2O5S — CID 132671646
2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-(3-prop-2-enoxyphenyl)propanamide (PubChem CID 132671646) has the molecular formula C20H23ClN2O5S and a molecular weight of 438.93 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-(3-prop-2-enoxyphenyl)propanamide.
| Compound Name | 2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-(3-prop-2-enoxyphenyl)propanamide |
|---|---|
| PubChem CID | 132671646 |
| Molecular Formula | C20H23ClN2O5S |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-(3-prop-2-enoxyphenyl)propanamide |
| SMILES | C=CCOc1cccc(NC(=O)C(C)N(c2cc(Cl)ccc2OC)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H23ClN2O5S/c1-5-11-28-17-8-6-7-16(13-17)22-20(24)14(2)23(29(4,25)26)18-12-15(21)9-10-19(18)27-3/h5-10,12-14H,1,11H2,2-4H3,(H,22,24) |
| InChIKey | AOZDPYHNPVWDSO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|