C15H15Cl2N3O3S — CID 126393592
(2S)-2-[(2,5-dichlorophenyl)sulfonylamino]-N-(pyridin-4-ylmethyl)propanamide (PubChem CID 126393592) has the molecular formula C15H15Cl2N3O3S and a molecular weight of 388.28 g/mol. Its IUPAC name is (2S)-2-[(2,5-dichlorophenyl)sulfonylamino]-N-(pyridin-4-ylmethyl)propanamide.
| Compound Name | (2S)-2-[(2,5-dichlorophenyl)sulfonylamino]-N-(pyridin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 126393592 |
| Molecular Formula | C15H15Cl2N3O3S |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | (2S)-2-[(2,5-dichlorophenyl)sulfonylamino]-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | C[C@H](NS(=O)(=O)c1cc(Cl)ccc1Cl)C(=O)NCc1ccncc1 |
| InChI | InChI=1S/C15H15Cl2N3O3S/c1-10(15(21)19-9-11-4-6-18-7-5-11)20-24(22,23)14-8-12(16)2-3-13(14)17/h2-8,10,20H,9H2,1H3,(H,19,21)/t10-/m0/s1 |
| InChIKey | GCHDNYSPGLHDEV-JTQLQIEISA-N |
| XLogP | 2.37 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |