C23H37Cl2N3O4S — CID 44565357
2-[(2,5-dichlorophenyl)sulfonylamino]-N,N'-dihexylpentanediamide (PubChem CID 44565357) has the molecular formula C23H37Cl2N3O4S and a molecular weight of 522.54 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)sulfonylamino]-N,N'-dihexylpentanediamide.
| Compound Name | 2-[(2,5-dichlorophenyl)sulfonylamino]-N,N'-dihexylpentanediamide |
|---|---|
| PubChem CID | 44565357 |
| Molecular Formula | C23H37Cl2N3O4S |
| Molecular Weight | 522.54 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)sulfonylamino]-N,N'-dihexylpentanediamide |
| SMILES | CCCCCCNC(=O)CCC(NS(=O)(=O)c1cc(Cl)ccc1Cl)C(=O)NCCCCCC |
| InChI | InChI=1S/C23H37Cl2N3O4S/c1-3-5-7-9-15-26-22(29)14-13-20(23(30)27-16-10-8-6-4-2)28-33(31,32)21-17-18(24)11-12-19(21)25/h11-12,17,20,28H,3-10,13-16H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | RYZXTLZAIMGNES-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|