C18H28Cl2N2O3S2 — CID 43019434
2-[(2,5-dichlorophenyl)sulfonylamino]-N-heptan-2-yl-4-methylsulfanylbutanamide (PubChem CID 43019434) has the molecular formula C18H28Cl2N2O3S2 and a molecular weight of 455.47 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)sulfonylamino]-N-heptan-2-yl-4-methylsulfanylbutanamide.
| Compound Name | 2-[(2,5-dichlorophenyl)sulfonylamino]-N-heptan-2-yl-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 43019434 |
| Molecular Formula | C18H28Cl2N2O3S2 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)sulfonylamino]-N-heptan-2-yl-4-methylsulfanylbutanamide |
| SMILES | CCCCCC(C)NC(=O)C(CCSC)NS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H28Cl2N2O3S2/c1-4-5-6-7-13(2)21-18(23)16(10-11-26-3)22-27(24,25)17-12-14(19)8-9-15(17)20/h8-9,12-13,16,22H,4-7,10-11H2,1-3H3,(H,21,23) |
| InChIKey | QMNWRMAQWMGYRW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|