C19H29Cl2N3O4S — CID 25199435
(2S)-2-[(2,5-dichlorophenyl)sulfonylamino]-N,N'-bis(2-methylpropyl)pentanediamide (PubChem CID 25199435) has the molecular formula C19H29Cl2N3O4S and a molecular weight of 466.43 g/mol. Its IUPAC name is (2S)-2-[(2,5-dichlorophenyl)sulfonylamino]-N,N'-bis(2-methylpropyl)pentanediamide.
| Compound Name | (2S)-2-[(2,5-dichlorophenyl)sulfonylamino]-N,N'-bis(2-methylpropyl)pentanediamide |
|---|---|
| PubChem CID | 25199435 |
| Molecular Formula | C19H29Cl2N3O4S |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | (2S)-2-[(2,5-dichlorophenyl)sulfonylamino]-N,N'-bis(2-methylpropyl)pentanediamide |
| SMILES | CC(C)CNC(=O)CC[C@H](NS(=O)(=O)c1cc(Cl)ccc1Cl)C(=O)NCC(C)C |
| InChI | InChI=1S/C19H29Cl2N3O4S/c1-12(2)10-22-18(25)8-7-16(19(26)23-11-13(3)4)24-29(27,28)17-9-14(20)5-6-15(17)21/h5-6,9,12-13,16,24H,7-8,10-11H2,1-4H3,(H,22,25)(H,23,26)/t16-/m0/s1 |
| InChIKey | SAWRQLQIDSYVIJ-INIZCTEOSA-N |
| XLogP | 2.96 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |