C20H23N3O5 — CID 55775627
N-(3-acetamido-4-methoxyphenyl)-3-[2-(dimethylamino)-2-oxoethoxy]benzamide (PubChem CID 55775627) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is N-(3-acetamido-4-methoxyphenyl)-3-[2-(dimethylamino)-2-oxoethoxy]benzamide.
| Compound Name | N-(3-acetamido-4-methoxyphenyl)-3-[2-(dimethylamino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 55775627 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-(3-acetamido-4-methoxyphenyl)-3-[2-(dimethylamino)-2-oxoethoxy]benzamide |
| SMILES | COc1ccc(NC(=O)c2cccc(OCC(=O)N(C)C)c2)cc1NC(C)=O |
| InChI | InChI=1S/C20H23N3O5/c1-13(24)21-17-11-15(8-9-18(17)27-4)22-20(26)14-6-5-7-16(10-14)28-12-19(25)23(2)3/h5-11H,12H2,1-4H3,(H,21,24)(H,22,26) |
| InChIKey | SXVGKMUVRUIFHW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |