C18H20N4O4 — CID 55823894
N-[3-(carbamoylamino)phenyl]-3-[2-(dimethylamino)-2-oxoethoxy]benzamide (PubChem CID 55823894) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is N-[3-(carbamoylamino)phenyl]-3-[2-(dimethylamino)-2-oxoethoxy]benzamide.
| Compound Name | N-[3-(carbamoylamino)phenyl]-3-[2-(dimethylamino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 55823894 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N-[3-(carbamoylamino)phenyl]-3-[2-(dimethylamino)-2-oxoethoxy]benzamide |
| SMILES | CN(C)C(=O)COc1cccc(C(=O)Nc2cccc(NC(N)=O)c2)c1 |
| InChI | InChI=1S/C18H20N4O4/c1-22(2)16(23)11-26-15-8-3-5-12(9-15)17(24)20-13-6-4-7-14(10-13)21-18(19)25/h3-10H,11H2,1-2H3,(H,20,24)(H3,19,21,25) |
| InChIKey | RTHGPELGGSTXHB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |