C14H20BrNO5 — CID 114309219
N-[2-(2-bromoethoxy)ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 114309219) has the molecular formula C14H20BrNO5 and a molecular weight of 362.22 g/mol. Its IUPAC name is N-[2-(2-bromoethoxy)ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(2-bromoethoxy)ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 114309219 |
| Molecular Formula | C14H20BrNO5 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | N-[2-(2-bromoethoxy)ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCOCCBr)cc(OC)c1OC |
| InChI | InChI=1S/C14H20BrNO5/c1-18-11-8-10(9-12(19-2)13(11)20-3)14(17)16-5-7-21-6-4-15/h8-9H,4-7H2,1-3H3,(H,16,17) |
| InChIKey | KOXRJGBVPPNGQF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|