C15H20ClNO4 — CID 115699665
3-chloro-4,5-dimethoxy-N-[2-(2-methylprop-2-enoxy)ethyl]benzamide (PubChem CID 115699665) has the molecular formula C15H20ClNO4 and a molecular weight of 313.78 g/mol. Its IUPAC name is 3-chloro-4,5-dimethoxy-N-[2-(2-methylprop-2-enoxy)ethyl]benzamide.
| Compound Name | 3-chloro-4,5-dimethoxy-N-[2-(2-methylprop-2-enoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 115699665 |
| Molecular Formula | C15H20ClNO4 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-chloro-4,5-dimethoxy-N-[2-(2-methylprop-2-enoxy)ethyl]benzamide |
| SMILES | C=C(C)COCCNC(=O)c1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H20ClNO4/c1-10(2)9-21-6-5-17-15(18)11-7-12(16)14(20-4)13(8-11)19-3/h7-8H,1,5-6,9H2,2-4H3,(H,17,18) |
| InChIKey | ZMXDMFISZNAHFK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|