C13H17ClO4 — CID 79567841
1-(3-chloro-4,5-dimethoxyphenyl)-2-propoxyethanone (PubChem CID 79567841) has the molecular formula C13H17ClO4 and a molecular weight of 272.73 g/mol. Its IUPAC name is 1-(3-chloro-4,5-dimethoxyphenyl)-2-propoxyethanone.
| Compound Name | 1-(3-chloro-4,5-dimethoxyphenyl)-2-propoxyethanone |
|---|---|
| PubChem CID | 79567841 |
| Molecular Formula | C13H17ClO4 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1-(3-chloro-4,5-dimethoxyphenyl)-2-propoxyethanone |
| SMILES | CCCOCC(=O)c1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C13H17ClO4/c1-4-5-18-8-11(15)9-6-10(14)13(17-3)12(7-9)16-2/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | OAQFFLMUQAFNTR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|